C9H20N2O2S — CID 127671510
1,1-dimethyl-4-[(sulfamoylamino)methyl]cyclohexane (PubChem CID 127671510) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 1,1-dimethyl-4-[(sulfamoylamino)methyl]cyclohexane.
| Compound Name | 1,1-dimethyl-4-[(sulfamoylamino)methyl]cyclohexane |
|---|---|
| PubChem CID | 127671510 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1,1-dimethyl-4-[(sulfamoylamino)methyl]cyclohexane |
| SMILES | CC1(C)CCC(CNS(N)(=O)=O)CC1 |
| InChI | InChI=1S/C9H20N2O2S/c1-9(2)5-3-8(4-6-9)7-11-14(10,12)13/h8,11H,3-7H2,1-2H3,(H2,10,12,13) |
| InChIKey | LHZSSGBZFYBPCS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |