C5H12N2O5S — CID 174832260
2,2-dihydroxy-5-[(sulfamoylamino)methyl]oxolane (PubChem CID 174832260) has the molecular formula C5H12N2O5S and a molecular weight of 212.23 g/mol. Its IUPAC name is 2,2-dihydroxy-5-[(sulfamoylamino)methyl]oxolane.
| Compound Name | 2,2-dihydroxy-5-[(sulfamoylamino)methyl]oxolane |
|---|---|
| PubChem CID | 174832260 |
| Molecular Formula | C5H12N2O5S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 2,2-dihydroxy-5-[(sulfamoylamino)methyl]oxolane |
| SMILES | NS(=O)(=O)NCC1CCC(O)(O)O1 |
| InChI | InChI=1S/C5H12N2O5S/c6-13(10,11)7-3-4-1-2-5(8,9)12-4/h4,7-9H,1-3H2,(H2,6,10,11) |
| InChIKey | MNLURPRSVPLXQP-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|