C9H19NO3S — CID 159631931
N-[[(2S)-6,6-dimethyloxan-2-yl]methyl]methanesulfonamide (PubChem CID 159631931) has the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. Its IUPAC name is N-[[(2S)-6,6-dimethyloxan-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(2S)-6,6-dimethyloxan-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 159631931 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-[[(2S)-6,6-dimethyloxan-2-yl]methyl]methanesulfonamide |
| SMILES | CC1(C)CCC[C@@H](CNS(C)(=O)=O)O1 |
| InChI | InChI=1S/C9H19NO3S/c1-9(2)6-4-5-8(13-9)7-10-14(3,11)12/h8,10H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | BGRTWJDKBNLGEY-QMMMGPOBSA-N |
| XLogP | 0.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |