C11H24N2O3S — CID 114175166
N-[3-[(5,5-dimethyloxolan-2-yl)methylamino]propyl]methanesulfonamide (PubChem CID 114175166) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is N-[3-[(5,5-dimethyloxolan-2-yl)methylamino]propyl]methanesulfonamide.
| Compound Name | N-[3-[(5,5-dimethyloxolan-2-yl)methylamino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 114175166 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-[3-[(5,5-dimethyloxolan-2-yl)methylamino]propyl]methanesulfonamide |
| SMILES | CC1(C)CCC(CNCCCNS(C)(=O)=O)O1 |
| InChI | InChI=1S/C11H24N2O3S/c1-11(2)6-5-10(16-11)9-12-7-4-8-13-17(3,14)15/h10,12-13H,4-9H2,1-3H3 |
| InChIKey | MZMAIPSBELCRTA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|