C11H20N4O — CID 116521666
N-[(5,5-dimethyloxolan-2-yl)methyl]-2-(triazol-1-yl)ethanamine (PubChem CID 116521666) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is N-[(5,5-dimethyloxolan-2-yl)methyl]-2-(triazol-1-yl)ethanamine.
| Compound Name | N-[(5,5-dimethyloxolan-2-yl)methyl]-2-(triazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 116521666 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | N-[(5,5-dimethyloxolan-2-yl)methyl]-2-(triazol-1-yl)ethanamine |
| SMILES | CC1(C)CCC(CNCCn2ccnn2)O1 |
| InChI | InChI=1S/C11H20N4O/c1-11(2)4-3-10(16-11)9-12-5-7-15-8-6-13-14-15/h6,8,10,12H,3-5,7,9H2,1-2H3 |
| InChIKey | GBHUPBHOCDSBAH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|