C10H18N4O2 — CID 106658992
2,2-dimethyl-N-[2-(triazol-1-yl)ethyl]-1,3-dioxan-5-amine (PubChem CID 106658992) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-(triazol-1-yl)ethyl]-1,3-dioxan-5-amine.
| Compound Name | 2,2-dimethyl-N-[2-(triazol-1-yl)ethyl]-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 106658992 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 2,2-dimethyl-N-[2-(triazol-1-yl)ethyl]-1,3-dioxan-5-amine |
| SMILES | CC1(C)OCC(NCCn2ccnn2)CO1 |
| InChI | InChI=1S/C10H18N4O2/c1-10(2)15-7-9(8-16-10)11-3-5-14-6-4-12-13-14/h4,6,9,11H,3,5,7-8H2,1-2H3 |
| InChIKey | PPSOQZVSJPGCLN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |