C12H22N4O — CID 113375264
2,2,5,5-tetramethyl-N-[2-(triazol-1-yl)ethyl]oxolan-3-amine (PubChem CID 113375264) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-[2-(triazol-1-yl)ethyl]oxolan-3-amine.
| Compound Name | 2,2,5,5-tetramethyl-N-[2-(triazol-1-yl)ethyl]oxolan-3-amine |
|---|---|
| PubChem CID | 113375264 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-[2-(triazol-1-yl)ethyl]oxolan-3-amine |
| SMILES | CC1(C)CC(NCCn2ccnn2)C(C)(C)O1 |
| InChI | InChI=1S/C12H22N4O/c1-11(2)9-10(12(3,4)17-11)13-5-7-16-8-6-14-15-16/h6,8,10,13H,5,7,9H2,1-4H3 |
| InChIKey | CKWDIYFEBDUSOW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |