C17H24N4 — CID 99604884
trans-(1S,3S)-2,2-dimethyl-3-phenyl-N-[3-(triazol-1-yl)propyl]cyclobutan-1-amine (PubChem CID 99604884) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is trans-(1S,3S)-2,2-dimethyl-3-phenyl-N-[3-(triazol-1-yl)propyl]cyclobutan-1-amine.
| Compound Name | trans-(1S,3S)-2,2-dimethyl-3-phenyl-N-[3-(triazol-1-yl)propyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 99604884 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | trans-(1S,3S)-2,2-dimethyl-3-phenyl-N-[3-(triazol-1-yl)propyl]cyclobutan-1-amine |
| SMILES | CC1(C)[C@@H](NCCCn2ccnn2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H24N4/c1-17(2)15(14-7-4-3-5-8-14)13-16(17)18-9-6-11-21-12-10-19-20-21/h3-5,7-8,10,12,15-16,18H,6,9,11,13H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | GFVGLTCLJPGYBN-HOTGVXAUSA-N |
| XLogP | 2.84 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|