C17H29N3O3 — CID 99706503
3-[2-[[(3R)-2,2,5,5-tetramethyloxolan-3-yl]amino]ethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 99706503) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-[2-[[(3R)-2,2,5,5-tetramethyloxolan-3-yl]amino]ethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[2-[[(3R)-2,2,5,5-tetramethyloxolan-3-yl]amino]ethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 99706503 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 3-[2-[[(3R)-2,2,5,5-tetramethyloxolan-3-yl]amino]ethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | CC1(C)C[C@@H](NCCN2C(=O)NC3(CCCC3)C2=O)C(C)(C)O1 |
| InChI | InChI=1S/C17H29N3O3/c1-15(2)11-12(16(3,4)23-15)18-9-10-20-13(21)17(19-14(20)22)7-5-6-8-17/h12,18H,5-11H2,1-4H3,(H,19,22)/t12-/m1/s1 |
| InChIKey | WIDROAHLYSVKFW-GFCCVEGCSA-N |
| XLogP | 1.79 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|