C10H16N4 — CID 107907909
N-[2-(triazol-1-yl)ethyl]cyclohex-2-en-1-amine (PubChem CID 107907909) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is N-[2-(triazol-1-yl)ethyl]cyclohex-2-en-1-amine.
| Compound Name | N-[2-(triazol-1-yl)ethyl]cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 107907909 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | N-[2-(triazol-1-yl)ethyl]cyclohex-2-en-1-amine |
| SMILES | C1=CC(NCCn2ccnn2)CCC1 |
| InChI | InChI=1S/C10H16N4/c1-2-4-10(5-3-1)11-6-8-14-9-7-12-13-14/h2,4,7,9-11H,1,3,5-6,8H2 |
| InChIKey | RBSHIWISTOIUON-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|