C8H18N2O3S — CID 112573807
1-hydroxy-4-methyl-1-[(sulfamoylamino)methyl]cyclohexane (PubChem CID 112573807) has the molecular formula C8H18N2O3S and a molecular weight of 222.31 g/mol. Its IUPAC name is 1-hydroxy-4-methyl-1-[(sulfamoylamino)methyl]cyclohexane.
| Compound Name | 1-hydroxy-4-methyl-1-[(sulfamoylamino)methyl]cyclohexane |
|---|---|
| PubChem CID | 112573807 |
| Molecular Formula | C8H18N2O3S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 1-hydroxy-4-methyl-1-[(sulfamoylamino)methyl]cyclohexane |
| SMILES | CC1CCC(O)(CNS(N)(=O)=O)CC1 |
| InChI | InChI=1S/C8H18N2O3S/c1-7-2-4-8(11,5-3-7)6-10-14(9,12)13/h7,10-11H,2-6H2,1H3,(H2,9,12,13) |
| InChIKey | NKUULEHTXVDVJF-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |