C11H22N2O3S — CID 114809564
1-[(cyclopropylsulfamoylamino)methyl]-4-methylcyclohexan-1-ol (PubChem CID 114809564) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 1-[(cyclopropylsulfamoylamino)methyl]-4-methylcyclohexan-1-ol.
| Compound Name | 1-[(cyclopropylsulfamoylamino)methyl]-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 114809564 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-[(cyclopropylsulfamoylamino)methyl]-4-methylcyclohexan-1-ol |
| SMILES | CC1CCC(O)(CNS(=O)(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C11H22N2O3S/c1-9-4-6-11(14,7-5-9)8-12-17(15,16)13-10-2-3-10/h9-10,12-14H,2-8H2,1H3 |
| InChIKey | FVPUOPNWEFZYLT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |