C9H18ClNO3S — CID 65123212
1-chloro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]methanesulfonamide (PubChem CID 65123212) has the molecular formula C9H18ClNO3S and a molecular weight of 255.77 g/mol. Its IUPAC name is 1-chloro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]methanesulfonamide.
| Compound Name | 1-chloro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 65123212 |
| Molecular Formula | C9H18ClNO3S |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 1-chloro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]methanesulfonamide |
| SMILES | CC1CCC(O)(CNS(=O)(=O)CCl)CC1 |
| InChI | InChI=1S/C9H18ClNO3S/c1-8-2-4-9(12,5-3-8)6-11-15(13,14)7-10/h8,11-12H,2-7H2,1H3 |
| InChIKey | RZVJMMJFCVOMDG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|