C12H18BrNO3S2 — CID 65121440
5-bromo-N-[(1-hydroxy-4-methylcyclohexyl)methyl]thiophene-2-sulfonamide (PubChem CID 65121440) has the molecular formula C12H18BrNO3S2 and a molecular weight of 368.32 g/mol. Its IUPAC name is 5-bromo-N-[(1-hydroxy-4-methylcyclohexyl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[(1-hydroxy-4-methylcyclohexyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 65121440 |
| Molecular Formula | C12H18BrNO3S2 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 5-bromo-N-[(1-hydroxy-4-methylcyclohexyl)methyl]thiophene-2-sulfonamide |
| SMILES | CC1CCC(O)(CNS(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C12H18BrNO3S2/c1-9-4-6-12(15,7-5-9)8-14-19(16,17)11-3-2-10(13)18-11/h2-3,9,14-15H,4-8H2,1H3 |
| InChIKey | ILUFEJZUQYSBRS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |