C13H19ClN2O4S — CID 65123017
5-chloro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 65123017) has the molecular formula C13H19ClN2O4S and a molecular weight of 334.83 g/mol. Its IUPAC name is 5-chloro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 65123017 |
| Molecular Formula | C13H19ClN2O4S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 5-chloro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | CC1CCC(O)(CNS(=O)(=O)c2c[nH]c(=O)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H19ClN2O4S/c1-9-2-4-13(18,5-3-9)8-16-21(19,20)10-6-11(14)12(17)15-7-10/h6-7,9,16,18H,2-5,8H2,1H3,(H,15,17) |
| InChIKey | VGZACJHKYLASHJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |