C11H24N2O4S — CID 114815694
1-[(2-methoxyethylsulfamoylamino)methyl]-4-methylcyclohexan-1-ol (PubChem CID 114815694) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-[(2-methoxyethylsulfamoylamino)methyl]-4-methylcyclohexan-1-ol.
| Compound Name | 1-[(2-methoxyethylsulfamoylamino)methyl]-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 114815694 |
| Molecular Formula | C11H24N2O4S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-[(2-methoxyethylsulfamoylamino)methyl]-4-methylcyclohexan-1-ol |
| SMILES | COCCNS(=O)(=O)NCC1(O)CCC(C)CC1 |
| InChI | InChI=1S/C11H24N2O4S/c1-10-3-5-11(14,6-4-10)9-13-18(15,16)12-7-8-17-2/h10,12-14H,3-9H2,1-2H3 |
| InChIKey | UGKIZPWKLDALHC-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|