C7H12N2O3 — CID 130597039
3-(methoxymethyl)-3-methylpiperazine-2,6-dione (PubChem CID 130597039) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is 3-(methoxymethyl)-3-methylpiperazine-2,6-dione.
| Compound Name | 3-(methoxymethyl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 130597039 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 3-(methoxymethyl)-3-methylpiperazine-2,6-dione |
| SMILES | COCC1(C)NCC(=O)NC1=O |
| InChI | InChI=1S/C7H12N2O3/c1-7(4-12-2)6(11)9-5(10)3-8-7/h8H,3-4H2,1-2H3,(H,9,10,11) |
| InChIKey | LLGHXHCLLBGGJL-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|