C7H14N4 — CID 130598738
1,1-dimethyl-2-[(1-methylimidazol-4-yl)methyl]hydrazine (PubChem CID 130598738) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is 1,1-dimethyl-2-[(1-methylimidazol-4-yl)methyl]hydrazine.
| Compound Name | 1,1-dimethyl-2-[(1-methylimidazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 130598738 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 1,1-dimethyl-2-[(1-methylimidazol-4-yl)methyl]hydrazine |
| SMILES | CN(C)NCc1cn(C)cn1 |
| InChI | InChI=1S/C7H14N4/c1-10(2)9-4-7-5-11(3)6-8-7/h5-6,9H,4H2,1-3H3 |
| InChIKey | UYRZYOWIZXSTBT-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|