C9H14BrN3 — CID 130599217
4-[3-(bromomethyl)-2,2-dimethylcyclopropyl]-1-methyltriazole (PubChem CID 130599217) has the molecular formula C9H14BrN3 and a molecular weight of 244.14 g/mol. Its IUPAC name is 4-[3-(bromomethyl)-2,2-dimethylcyclopropyl]-1-methyltriazole.
| Compound Name | 4-[3-(bromomethyl)-2,2-dimethylcyclopropyl]-1-methyltriazole |
|---|---|
| PubChem CID | 130599217 |
| Molecular Formula | C9H14BrN3 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 4-[3-(bromomethyl)-2,2-dimethylcyclopropyl]-1-methyltriazole |
| SMILES | Cn1cc(C2C(CBr)C2(C)C)nn1 |
| InChI | InChI=1S/C9H14BrN3/c1-9(2)6(4-10)8(9)7-5-13(3)12-11-7/h5-6,8H,4H2,1-3H3 |
| InChIKey | YDSRMPFXQDGINH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|