About azane;4-bromo-1-methyltriazole
azane;4-bromo-1-methyltriazole (PubChem CID 146597860) has the molecular formula C3H7BrN4
and a molecular weight of 179.02 g/mol. Its IUPAC name is azane;4-bromo-1-methyltriazole.
Molecular Properties
| Compound Name | azane;4-bromo-1-methyltriazole |
| PubChem CID | 146597860 |
| Molecular Formula | C3H7BrN4 |
| Molecular Weight | 179.02 g/mol |
| Exact Mass | 177.99 |
| IUPAC Name | azane;4-bromo-1-methyltriazole |
| SMILES | Cn1cc(Br)nn1.N |
| InChI | InChI=1S/C3H4BrN3.H3N/c1-7-2-3(4)5-6-7;/h2H,1H3;1H3 |
| InChIKey | BAQWGUTVQILRKC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.02 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;4-bromo-1-methyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-bromo-1-methyltriazole?
The IUPAC name of azane;4-bromo-1-methyltriazole (CID 146597860) is azane;4-bromo-1-methyltriazole.
What is the SMILES notation for azane;4-bromo-1-methyltriazole?
The canonical SMILES for azane;4-bromo-1-methyltriazole is Cn1cc(Br)nn1.N.
What is the InChIKey of azane;4-bromo-1-methyltriazole?
The InChIKey is BAQWGUTVQILRKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4BrN3.H3N/c1-7-2-3(4)5-6-7;/h2H,1H3;1H3.
What are the key properties of azane;4-bromo-1-methyltriazole?
azane;4-bromo-1-methyltriazole has a molecular weight of 179.02 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-bromo-1-methyltriazole is sourced from PubChem (CID 146597860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).