C11H21N3 — CID 134560662
1-methyl-4-(2,4,4-trimethylpentan-2-yl)triazole (PubChem CID 134560662) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-methyl-4-(2,4,4-trimethylpentan-2-yl)triazole.
| Compound Name | 1-methyl-4-(2,4,4-trimethylpentan-2-yl)triazole |
|---|---|
| PubChem CID | 134560662 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1-methyl-4-(2,4,4-trimethylpentan-2-yl)triazole |
| SMILES | Cn1cc(C(C)(C)CC(C)(C)C)nn1 |
| InChI | InChI=1S/C11H21N3/c1-10(2,3)8-11(4,5)9-7-14(6)13-12-9/h7H,8H2,1-6H3 |
| InChIKey | CILGJHAMGOXVCP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |