C14H32N4 — CID 171085136
2,4-dimethyl-4-(1-methyltriazol-4-yl)pentan-2-amine;ethane (PubChem CID 171085136) has the molecular formula C14H32N4 and a molecular weight of 256.44 g/mol. Its IUPAC name is 2,4-dimethyl-4-(1-methyltriazol-4-yl)pentan-2-amine;ethane.
| Compound Name | 2,4-dimethyl-4-(1-methyltriazol-4-yl)pentan-2-amine;ethane |
|---|---|
| PubChem CID | 171085136 |
| Molecular Formula | C14H32N4 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.26 |
| IUPAC Name | 2,4-dimethyl-4-(1-methyltriazol-4-yl)pentan-2-amine;ethane |
| SMILES | CC.CC.Cn1cc(C(C)(C)CC(C)(C)N)nn1 |
| InChI | InChI=1S/C10H20N4.2C2H6/c1-9(2,7-10(3,4)11)8-6-14(5)13-12-8;2*1-2/h6H,7,11H2,1-5H3;2*1-2H3 |
| InChIKey | JOIANBJXFXFLLC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |