C8H13N3O — CID 130604179
[1-(1H-imidazol-2-ylmethyl)azetidin-3-yl]methanol (PubChem CID 130604179) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is [1-(1H-imidazol-2-ylmethyl)azetidin-3-yl]methanol.
| Compound Name | [1-(1H-imidazol-2-ylmethyl)azetidin-3-yl]methanol |
|---|---|
| PubChem CID | 130604179 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | [1-(1H-imidazol-2-ylmethyl)azetidin-3-yl]methanol |
| SMILES | OCC1CN(Cc2ncc[nH]2)C1 |
| InChI | InChI=1S/C8H13N3O/c12-6-7-3-11(4-7)5-8-9-1-2-10-8/h1-2,7,12H,3-6H2,(H,9,10) |
| InChIKey | YKWGFAVPUGOXAD-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |