About N-methyl-1-[5-(1,2-thiazol-3-yl)-1,3-thiazol-2-yl]methanamine
N-methyl-1-[5-(1,2-thiazol-3-yl)-1,3-thiazol-2-yl]methanamine (PubChem CID 130604821) has the molecular formula C8H9N3S2
and a molecular weight of 211.32 g/mol. Its IUPAC name is N-methyl-1-[5-(1,2-thiazol-3-yl)-1,3-thiazol-2-yl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[5-(1,2-thiazol-3-yl)-1,3-thiazol-2-yl]methanamine |
| PubChem CID | 130604821 |
| Molecular Formula | C8H9N3S2 |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | N-methyl-1-[5-(1,2-thiazol-3-yl)-1,3-thiazol-2-yl]methanamine |
| SMILES | CNCc1ncc(-c2ccsn2)s1 |
| InChI | InChI=1S/C8H9N3S2/c1-9-5-8-10-4-7(13-8)6-2-3-12-11-6/h2-4,9H,5H2,1H3 |
| InChIKey | ICMWSBUTJAPTQM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-1-[5-(1,2-thiazol-3-yl)-1,3-thiazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[5-(1,2-thiazol-3-yl)-1,3-thiazol-2-yl]methanamine?
The IUPAC name of N-methyl-1-[5-(1,2-thiazol-3-yl)-1,3-thiazol-2-yl]methanamine (CID 130604821) is N-methyl-1-[5-(1,2-thiazol-3-yl)-1,3-thiazol-2-yl]methanamine.
What is the SMILES notation for N-methyl-1-[5-(1,2-thiazol-3-yl)-1,3-thiazol-2-yl]methanamine?
The canonical SMILES for N-methyl-1-[5-(1,2-thiazol-3-yl)-1,3-thiazol-2-yl]methanamine is CNCc1ncc(-c2ccsn2)s1.
What is the InChIKey of N-methyl-1-[5-(1,2-thiazol-3-yl)-1,3-thiazol-2-yl]methanamine?
The InChIKey is ICMWSBUTJAPTQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S2/c1-9-5-8-10-4-7(13-8)6-2-3-12-11-6/h2-4,9H,5H2,1H3.
What are the key properties of N-methyl-1-[5-(1,2-thiazol-3-yl)-1,3-thiazol-2-yl]methanamine?
N-methyl-1-[5-(1,2-thiazol-3-yl)-1,3-thiazol-2-yl]methanamine has a molecular weight of 211.32 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[5-(1,2-thiazol-3-yl)-1,3-thiazol-2-yl]methanamine is sourced from PubChem (CID 130604821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).