C8H8BrN3O — CID 130605439
6-bromo-2-methyl-N-prop-2-ynoxypyrimidin-4-amine (PubChem CID 130605439) has the molecular formula C8H8BrN3O and a molecular weight of 242.08 g/mol. Its IUPAC name is 6-bromo-2-methyl-N-prop-2-ynoxypyrimidin-4-amine.
| Compound Name | 6-bromo-2-methyl-N-prop-2-ynoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 130605439 |
| Molecular Formula | C8H8BrN3O |
| Molecular Weight | 242.08 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | 6-bromo-2-methyl-N-prop-2-ynoxypyrimidin-4-amine |
| SMILES | C#CCONc1cc(Br)nc(C)n1 |
| InChI | InChI=1S/C8H8BrN3O/c1-3-4-13-12-8-5-7(9)10-6(2)11-8/h1,5H,4H2,2H3,(H,10,11,12) |
| InChIKey | BCTCMKTVPNMISV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.08 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|