C11H13N3 — CID 130606548
(3S)-3-amino-3-(2,3-dihydro-1H-indol-7-yl)propanenitrile (PubChem CID 130606548) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is (3S)-3-amino-3-(2,3-dihydro-1H-indol-7-yl)propanenitrile.
| Compound Name | (3S)-3-amino-3-(2,3-dihydro-1H-indol-7-yl)propanenitrile |
|---|---|
| PubChem CID | 130606548 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | (3S)-3-amino-3-(2,3-dihydro-1H-indol-7-yl)propanenitrile |
| SMILES | N#CC[C@H](N)c1cccc2c1NCC2 |
| InChI | InChI=1S/C11H13N3/c12-6-4-10(13)9-3-1-2-8-5-7-14-11(8)9/h1-3,10,14H,4-5,7,13H2/t10-/m0/s1 |
| InChIKey | BPVLZBKAUNBLGR-JTQLQIEISA-N |
| XLogP | 1.57 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |