C8H13ClN2O2 — CID 130608806
1-[(2-chloroacetyl)amino]cyclopentane-1-carboxamide (PubChem CID 130608806) has the molecular formula C8H13ClN2O2 and a molecular weight of 204.66 g/mol. Its IUPAC name is 1-[(2-chloroacetyl)amino]cyclopentane-1-carboxamide.
| Compound Name | 1-[(2-chloroacetyl)amino]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 130608806 |
| Molecular Formula | C8H13ClN2O2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 1-[(2-chloroacetyl)amino]cyclopentane-1-carboxamide |
| SMILES | NC(=O)C1(NC(=O)CCl)CCCC1 |
| InChI | InChI=1S/C8H13ClN2O2/c9-5-6(12)11-8(7(10)13)3-1-2-4-8/h1-5H2,(H2,10,13)(H,11,12) |
| InChIKey | OWSVIHRJPLUICX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|