C18H33N3O4 — CID 154915324
formic acid;1-[[2-(2,2,6,6-tetramethylpiperidin-4-yl)acetyl]amino]cyclopentane-1-carboxamide (PubChem CID 154915324) has the molecular formula C18H33N3O4 and a molecular weight of 355.48 g/mol. Its IUPAC name is formic acid;1-[[2-(2,2,6,6-tetramethylpiperidin-4-yl)acetyl]amino]cyclopentane-1-carboxamide.
| Compound Name | formic acid;1-[[2-(2,2,6,6-tetramethylpiperidin-4-yl)acetyl]amino]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 154915324 |
| Molecular Formula | C18H33N3O4 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | formic acid;1-[[2-(2,2,6,6-tetramethylpiperidin-4-yl)acetyl]amino]cyclopentane-1-carboxamide |
| SMILES | CC1(C)CC(CC(=O)NC2(C(N)=O)CCCC2)CC(C)(C)N1.O=CO |
| InChI | InChI=1S/C17H31N3O2.CH2O2/c1-15(2)10-12(11-16(3,4)20-15)9-13(21)19-17(14(18)22)7-5-6-8-17;2-1-3/h12,20H,5-11H2,1-4H3,(H2,18,22)(H,19,21);1H,(H,2,3) |
| InChIKey | QDFGSVVKZCIREK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|