C8H16N2O3 — CID 130609050
3-hydroxy-N-[(2S)-1-hydroxypropan-2-yl]pyrrolidine-1-carboxamide (PubChem CID 130609050) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-hydroxy-N-[(2S)-1-hydroxypropan-2-yl]pyrrolidine-1-carboxamide.
| Compound Name | 3-hydroxy-N-[(2S)-1-hydroxypropan-2-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 130609050 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 3-hydroxy-N-[(2S)-1-hydroxypropan-2-yl]pyrrolidine-1-carboxamide |
| SMILES | C[C@@H](CO)NC(=O)N1CCC(O)C1 |
| InChI | InChI=1S/C8H16N2O3/c1-6(5-11)9-8(13)10-3-2-7(12)4-10/h6-7,11-12H,2-5H2,1H3,(H,9,13)/t6-,7?/m0/s1 |
| InChIKey | QZFRTMDOVCITAT-PKPIPKONSA-N |
| XLogP | -0.86 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |