C8H10N2O2S — CID 130609101
N-[(1S)-1-cyanoethyl]-5-oxothiolane-3-carboxamide (PubChem CID 130609101) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is N-[(1S)-1-cyanoethyl]-5-oxothiolane-3-carboxamide.
| Compound Name | N-[(1S)-1-cyanoethyl]-5-oxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 130609101 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | N-[(1S)-1-cyanoethyl]-5-oxothiolane-3-carboxamide |
| SMILES | C[C@@H](C#N)NC(=O)C1CSC(=O)C1 |
| InChI | InChI=1S/C8H10N2O2S/c1-5(3-9)10-8(12)6-2-7(11)13-4-6/h5-6H,2,4H2,1H3,(H,10,12)/t5-,6?/m0/s1 |
| InChIKey | IXNGYVBXQZTGBZ-ZBHICJROSA-N |
| XLogP | 0.29 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|