C14H23Cl — CID 130609858
2-[3-(chloromethyl)-1,2,2-trimethylcyclopropyl]bicyclo[2.2.1]heptane (PubChem CID 130609858) has the molecular formula C14H23Cl and a molecular weight of 226.79 g/mol. Its IUPAC name is 2-[3-(chloromethyl)-1,2,2-trimethylcyclopropyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-[3-(chloromethyl)-1,2,2-trimethylcyclopropyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 130609858 |
| Molecular Formula | C14H23Cl |
| Molecular Weight | 226.79 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 2-[3-(chloromethyl)-1,2,2-trimethylcyclopropyl]bicyclo[2.2.1]heptane |
| SMILES | CC1(C)C(CCl)C1(C)C1CC2CCC1C2 |
| InChI | InChI=1S/C14H23Cl/c1-13(2)12(8-15)14(13,3)11-7-9-4-5-10(11)6-9/h9-12H,4-8H2,1-3H3 |
| InChIKey | NHZOTIMIUGTQCL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.79 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|