C8H15FN2O — CID 130610311
3-[(1R,2S)-2-fluorocyclopentyl]-1,1-dimethylurea (PubChem CID 130610311) has the molecular formula C8H15FN2O and a molecular weight of 174.22 g/mol. Its IUPAC name is 3-[(1R,2S)-2-fluorocyclopentyl]-1,1-dimethylurea.
| Compound Name | 3-[(1R,2S)-2-fluorocyclopentyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 130610311 |
| Molecular Formula | C8H15FN2O |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 3-[(1R,2S)-2-fluorocyclopentyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)N[C@@H]1CCC[C@@H]1F |
| InChI | InChI=1S/C8H15FN2O/c1-11(2)8(12)10-7-5-3-4-6(7)9/h6-7H,3-5H2,1-2H3,(H,10,12)/t6-,7+/m0/s1 |
| InChIKey | HLAKGVYQVFFKLG-NKWVEPMBSA-N |
| XLogP | 1.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |