C6H10F2N2O — CID 140633335
[(1R)-3,3-difluorocyclopentyl]urea (PubChem CID 140633335) has the molecular formula C6H10F2N2O and a molecular weight of 164.16 g/mol. Its IUPAC name is [(1R)-3,3-difluorocyclopentyl]urea.
| Compound Name | [(1R)-3,3-difluorocyclopentyl]urea |
|---|---|
| PubChem CID | 140633335 |
| Molecular Formula | C6H10F2N2O |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | [(1R)-3,3-difluorocyclopentyl]urea |
| SMILES | NC(=O)N[C@@H]1CCC(F)(F)C1 |
| InChI | InChI=1S/C6H10F2N2O/c7-6(8)2-1-4(3-6)10-5(9)11/h4H,1-3H2,(H3,9,10,11)/t4-/m1/s1 |
| InChIKey | ZJYCWGKWPZDUNE-SCSAIBSYSA-N |
| XLogP | 0.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |