C5H8F2N2O — CID 89360103
(3,3-difluorocyclobutyl)urea (PubChem CID 89360103) has the molecular formula C5H8F2N2O and a molecular weight of 150.13 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)urea.
| Compound Name | (3,3-difluorocyclobutyl)urea |
|---|---|
| PubChem CID | 89360103 |
| Molecular Formula | C5H8F2N2O |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.06 |
| IUPAC Name | (3,3-difluorocyclobutyl)urea |
| SMILES | NC(=O)NC1CC(F)(F)C1 |
| InChI | InChI=1S/C5H8F2N2O/c6-5(7)1-3(2-5)9-4(8)10/h3H,1-2H2,(H3,8,9,10) |
| InChIKey | RULIIIJMFVTGCE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |