C9H10BrNOS — CID 130610492
N-(2-bromoprop-2-enyl)-5-methylthiophene-3-carboxamide (PubChem CID 130610492) has the molecular formula C9H10BrNOS and a molecular weight of 260.16 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-5-methylthiophene-3-carboxamide.
| Compound Name | N-(2-bromoprop-2-enyl)-5-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 130610492 |
| Molecular Formula | C9H10BrNOS |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 258.97 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-5-methylthiophene-3-carboxamide |
| SMILES | C=C(Br)CNC(=O)c1csc(C)c1 |
| InChI | InChI=1S/C9H10BrNOS/c1-6(10)4-11-9(12)8-3-7(2)13-5-8/h3,5H,1,4H2,2H3,(H,11,12) |
| InChIKey | XCZZBMVTDYIJSN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |