C8H7Br2NOS — CID 115594394
5-bromo-N-(2-bromoprop-2-enyl)thiophene-3-carboxamide (PubChem CID 115594394) has the molecular formula C8H7Br2NOS and a molecular weight of 325.03 g/mol. Its IUPAC name is 5-bromo-N-(2-bromoprop-2-enyl)thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-(2-bromoprop-2-enyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 115594394 |
| Molecular Formula | C8H7Br2NOS |
| Molecular Weight | 325.03 g/mol |
| Exact Mass | 322.86 |
| IUPAC Name | 5-bromo-N-(2-bromoprop-2-enyl)thiophene-3-carboxamide |
| SMILES | C=C(Br)CNC(=O)c1csc(Br)c1 |
| InChI | InChI=1S/C8H7Br2NOS/c1-5(9)3-11-8(12)6-2-7(10)13-4-6/h2,4H,1,3H2,(H,11,12) |
| InChIKey | NPOKNNAZTBLJMQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.03 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |