C10H11BrN2O2S — CID 43424485
5-bromo-N-[2-(cyclopropylamino)-2-oxoethyl]thiophene-3-carboxamide (PubChem CID 43424485) has the molecular formula C10H11BrN2O2S and a molecular weight of 303.18 g/mol. Its IUPAC name is 5-bromo-N-[2-(cyclopropylamino)-2-oxoethyl]thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-[2-(cyclopropylamino)-2-oxoethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 43424485 |
| Molecular Formula | C10H11BrN2O2S |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 5-bromo-N-[2-(cyclopropylamino)-2-oxoethyl]thiophene-3-carboxamide |
| SMILES | O=C(CNC(=O)c1csc(Br)c1)NC1CC1 |
| InChI | InChI=1S/C10H11BrN2O2S/c11-8-3-6(5-16-8)10(15)12-4-9(14)13-7-1-2-7/h3,5,7H,1-2,4H2,(H,12,15)(H,13,14) |
| InChIKey | GMPSKWTYWBRKJP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |