C11H13BrN2O2S — CID 79929074
5-bromo-N-[2-(cyclopropylamino)-2-oxoethyl]-4-methylthiophene-2-carboxamide (PubChem CID 79929074) has the molecular formula C11H13BrN2O2S and a molecular weight of 317.21 g/mol. Its IUPAC name is 5-bromo-N-[2-(cyclopropylamino)-2-oxoethyl]-4-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[2-(cyclopropylamino)-2-oxoethyl]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79929074 |
| Molecular Formula | C11H13BrN2O2S |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 5-bromo-N-[2-(cyclopropylamino)-2-oxoethyl]-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(=O)NC2CC2)sc1Br |
| InChI | InChI=1S/C11H13BrN2O2S/c1-6-4-8(17-10(6)12)11(16)13-5-9(15)14-7-2-3-7/h4,7H,2-3,5H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | OOWBOBWRKZCWMV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |