C10H11NO4 — CID 13061094
dimethyl 2-cyanocyclopent-3-ene-1,2-dicarboxylate (PubChem CID 13061094) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is dimethyl 2-cyanocyclopent-3-ene-1,2-dicarboxylate.
| Compound Name | dimethyl 2-cyanocyclopent-3-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 13061094 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | dimethyl 2-cyanocyclopent-3-ene-1,2-dicarboxylate |
| SMILES | COC(=O)C1CC=CC1(C#N)C(=O)OC |
| InChI | InChI=1S/C10H11NO4/c1-14-8(12)7-4-3-5-10(7,6-11)9(13)15-2/h3,5,7H,4H2,1-2H3 |
| InChIKey | CJVSPOPBZOOZQE-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|