C8H10BrF2NOS — CID 130612108
(3S)-3-amino-3-(3-bromothiophen-2-yl)-2,2-difluorobutan-1-ol (PubChem CID 130612108) has the molecular formula C8H10BrF2NOS and a molecular weight of 286.14 g/mol. Its IUPAC name is (3S)-3-amino-3-(3-bromothiophen-2-yl)-2,2-difluorobutan-1-ol.
| Compound Name | (3S)-3-amino-3-(3-bromothiophen-2-yl)-2,2-difluorobutan-1-ol |
|---|---|
| PubChem CID | 130612108 |
| Molecular Formula | C8H10BrF2NOS |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 284.96 |
| IUPAC Name | (3S)-3-amino-3-(3-bromothiophen-2-yl)-2,2-difluorobutan-1-ol |
| SMILES | C[C@@](N)(c1sccc1Br)C(F)(F)CO |
| InChI | InChI=1S/C8H10BrF2NOS/c1-7(12,8(10,11)4-13)6-5(9)2-3-14-6/h2-3,13H,4,12H2,1H3/t7-/m1/s1 |
| InChIKey | LONQYKXBZCVFGB-SSDOTTSWSA-N |
| XLogP | 2.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |