C6H10N4OS2 — CID 130612870
(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)urea (PubChem CID 130612870) has the molecular formula C6H10N4OS2 and a molecular weight of 218.31 g/mol. Its IUPAC name is (3-propylsulfanyl-1,2,4-thiadiazol-5-yl)urea.
| Compound Name | (3-propylsulfanyl-1,2,4-thiadiazol-5-yl)urea |
|---|---|
| PubChem CID | 130612870 |
| Molecular Formula | C6H10N4OS2 |
| Molecular Weight | 218.31 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | (3-propylsulfanyl-1,2,4-thiadiazol-5-yl)urea |
| SMILES | CCCSc1nsc(NC(N)=O)n1 |
| InChI | InChI=1S/C6H10N4OS2/c1-2-3-12-6-9-5(13-10-6)8-4(7)11/h2-3H2,1H3,(H3,7,8,9,10,11) |
| InChIKey | MYQKMHUSEGZNEW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |