C10H12N6O2S2 — CID 66214373
2-(4-formyltriazol-1-yl)-N-(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)acetamide (PubChem CID 66214373) has the molecular formula C10H12N6O2S2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 2-(4-formyltriazol-1-yl)-N-(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)acetamide.
| Compound Name | 2-(4-formyltriazol-1-yl)-N-(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 66214373 |
| Molecular Formula | C10H12N6O2S2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-(4-formyltriazol-1-yl)-N-(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)acetamide |
| SMILES | CCCSc1nsc(NC(=O)Cn2cc(C=O)nn2)n1 |
| InChI | InChI=1S/C10H12N6O2S2/c1-2-3-19-10-12-9(20-14-10)11-8(18)5-16-4-7(6-17)13-15-16/h4,6H,2-3,5H2,1H3,(H,11,12,14,18) |
| InChIKey | JWTCXOSIIXMIOW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|