C6H7N5O3 — CID 66214589
N-carbamoyl-2-(4-formyltriazol-1-yl)acetamide (PubChem CID 66214589) has the molecular formula C6H7N5O3 and a molecular weight of 197.15 g/mol. Its IUPAC name is N-carbamoyl-2-(4-formyltriazol-1-yl)acetamide.
| Compound Name | N-carbamoyl-2-(4-formyltriazol-1-yl)acetamide |
|---|---|
| PubChem CID | 66214589 |
| Molecular Formula | C6H7N5O3 |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | N-carbamoyl-2-(4-formyltriazol-1-yl)acetamide |
| SMILES | NC(=O)NC(=O)Cn1cc(C=O)nn1 |
| InChI | InChI=1S/C6H7N5O3/c7-6(14)8-5(13)2-11-1-4(3-12)9-10-11/h1,3H,2H2,(H3,7,8,13,14) |
| InChIKey | IEIKNULSYNNREW-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|