C7H7F3N4O2 — CID 66215009
2-(4-formyltriazol-1-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 66215009) has the molecular formula C7H7F3N4O2 and a molecular weight of 236.15 g/mol. Its IUPAC name is 2-(4-formyltriazol-1-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(4-formyltriazol-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 66215009 |
| Molecular Formula | C7H7F3N4O2 |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-(4-formyltriazol-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=Cc1cn(CC(=O)NCC(F)(F)F)nn1 |
| InChI | InChI=1S/C7H7F3N4O2/c8-7(9,10)4-11-6(16)2-14-1-5(3-15)12-13-14/h1,3H,2,4H2,(H,11,16) |
| InChIKey | BAFLIADTQFYDIX-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|