C12H11F3N4O — CID 163355208
2-(4-phenyltriazol-1-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 163355208) has the molecular formula C12H11F3N4O and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-(4-phenyltriazol-1-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(4-phenyltriazol-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 163355208 |
| Molecular Formula | C12H11F3N4O |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-(4-phenyltriazol-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(Cn1cc(-c2ccccc2)nn1)NCC(F)(F)F |
| InChI | InChI=1S/C12H11F3N4O/c13-12(14,15)8-16-11(20)7-19-6-10(17-18-19)9-4-2-1-3-5-9/h1-6H,7-8H2,(H,16,20) |
| InChIKey | PFSPYOVCSBOHOM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |