C8H16N2O2S — CID 130614935
N'-(2-methyl-1,1-dioxothiolan-3-yl)propanimidamide (PubChem CID 130614935) has the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. Its IUPAC name is N'-(2-methyl-1,1-dioxothiolan-3-yl)propanimidamide.
| Compound Name | N'-(2-methyl-1,1-dioxothiolan-3-yl)propanimidamide |
|---|---|
| PubChem CID | 130614935 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | N'-(2-methyl-1,1-dioxothiolan-3-yl)propanimidamide |
| SMILES | CC/C(N)=N\C1CCS(=O)(=O)C1C |
| InChI | InChI=1S/C8H16N2O2S/c1-3-8(9)10-7-4-5-13(11,12)6(7)2/h6-7H,3-5H2,1-2H3,(H2,9,10) |
| InChIKey | VRAIOCKINBJDHU-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|