C7H10BrN3OS — CID 130615823
N-(5-bromo-1-methylpyrazol-3-yl)-2-methylsulfanylacetamide (PubChem CID 130615823) has the molecular formula C7H10BrN3OS and a molecular weight of 264.15 g/mol. Its IUPAC name is N-(5-bromo-1-methylpyrazol-3-yl)-2-methylsulfanylacetamide.
| Compound Name | N-(5-bromo-1-methylpyrazol-3-yl)-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 130615823 |
| Molecular Formula | C7H10BrN3OS |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | N-(5-bromo-1-methylpyrazol-3-yl)-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)Nc1cc(Br)n(C)n1 |
| InChI | InChI=1S/C7H10BrN3OS/c1-11-5(8)3-6(10-11)9-7(12)4-13-2/h3H,4H2,1-2H3,(H,9,10,12) |
| InChIKey | GUAIEYOQXOIPLA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |