About 1-(3,3-difluorocyclopentyl)-2H-tetrazole-5-thione
1-(3,3-difluorocyclopentyl)-2H-tetrazole-5-thione (PubChem CID 130616652) has the molecular formula C6H8F2N4S
and a molecular weight of 206.22 g/mol. Its IUPAC name is 1-(3,3-difluorocyclopentyl)-2H-tetrazole-5-thione.
Molecular Properties
| Compound Name | 1-(3,3-difluorocyclopentyl)-2H-tetrazole-5-thione |
| PubChem CID | 130616652 |
| Molecular Formula | C6H8F2N4S |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 1-(3,3-difluorocyclopentyl)-2H-tetrazole-5-thione |
| SMILES | FC1(F)CCC(n2[nH]nnc2=S)C1 |
| InChI | InChI=1S/C6H8F2N4S/c7-6(8)2-1-4(3-6)12-5(13)9-10-11-12/h4H,1-3H2,(H,9,11,13) |
| InChIKey | KQHGAQYXNQPZTD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-difluorocyclopentyl)-2H-tetrazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluorocyclopentyl)-2H-tetrazole-5-thione?
The IUPAC name of 1-(3,3-difluorocyclopentyl)-2H-tetrazole-5-thione (CID 130616652) is 1-(3,3-difluorocyclopentyl)-2H-tetrazole-5-thione.
What is the SMILES notation for 1-(3,3-difluorocyclopentyl)-2H-tetrazole-5-thione?
The canonical SMILES for 1-(3,3-difluorocyclopentyl)-2H-tetrazole-5-thione is FC1(F)CCC(n2[nH]nnc2=S)C1.
What is the InChIKey of 1-(3,3-difluorocyclopentyl)-2H-tetrazole-5-thione?
The InChIKey is KQHGAQYXNQPZTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N4S/c7-6(8)2-1-4(3-6)12-5(13)9-10-11-12/h4H,1-3H2,(H,9,11,13).
What are the key properties of 1-(3,3-difluorocyclopentyl)-2H-tetrazole-5-thione?
1-(3,3-difluorocyclopentyl)-2H-tetrazole-5-thione has a molecular weight of 206.22 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluorocyclopentyl)-2H-tetrazole-5-thione is sourced from PubChem (CID 130616652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).