C5H8F2N4S — CID 130677773
1-(4,4-difluorobutan-2-yl)-2H-tetrazole-5-thione (PubChem CID 130677773) has the molecular formula C5H8F2N4S and a molecular weight of 194.21 g/mol. Its IUPAC name is 1-(4,4-difluorobutan-2-yl)-2H-tetrazole-5-thione.
| Compound Name | 1-(4,4-difluorobutan-2-yl)-2H-tetrazole-5-thione |
|---|---|
| PubChem CID | 130677773 |
| Molecular Formula | C5H8F2N4S |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 1-(4,4-difluorobutan-2-yl)-2H-tetrazole-5-thione |
| SMILES | CC(CC(F)F)n1[nH]nnc1=S |
| InChI | InChI=1S/C5H8F2N4S/c1-3(2-4(6)7)11-5(12)8-9-10-11/h3-4H,2H2,1H3,(H,8,10,12) |
| InChIKey | KAFPJHVJTHWAFJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|