C4H4F4N4S — CID 106290492
1-(2,2,3,3-tetrafluoropropyl)-2H-tetrazole-5-thione (PubChem CID 106290492) has the molecular formula C4H4F4N4S and a molecular weight of 216.16 g/mol. Its IUPAC name is 1-(2,2,3,3-tetrafluoropropyl)-2H-tetrazole-5-thione.
| Compound Name | 1-(2,2,3,3-tetrafluoropropyl)-2H-tetrazole-5-thione |
|---|---|
| PubChem CID | 106290492 |
| Molecular Formula | C4H4F4N4S |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 1-(2,2,3,3-tetrafluoropropyl)-2H-tetrazole-5-thione |
| SMILES | FC(F)C(F)(F)Cn1[nH]nnc1=S |
| InChI | InChI=1S/C4H4F4N4S/c5-2(6)4(7,8)1-12-3(13)9-10-11-12/h2H,1H2,(H,9,11,13) |
| InChIKey | DNKJICXFFLELRO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|